A3484312
                    6,7-Dihydro-1<i>H</i>-indeno[5,4-<i>b</i>]furan-8(2<i>H</i>)-one , ≥98.0% , 196597-78-1
CAS NO.:196597-78-1
Empirical Formula: C11H10O2
Molecular Weight: 174.2
MDL number: MFCD09955085
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB79.20 | In Stock | 
                                                 | 
                                        
| 250MG | RMB151.20 | In Stock | 
                                                 | 
                                        
| 1G | RMB369.60 | In Stock | 
                                                 | 
                                        
| 5G | RMB1441.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB4683.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 149-1510C | 
                                    
| Boiling point: | 334.2±42.0 °C(Predicted) | 
                                    
| Density | 1.288±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| InChI | InChI=1S/C11H10O2/c12-9-3-1-7-2-4-10-8(11(7)9)5-6-13-10/h2,4H,1,3,5-6H2 | 
                                    
| InChIKey | ZZUIZMWFNOKNLN-UHFFFAOYSA-N | 
                                    
| SMILES | O1CCC2=C3C(CCC3=O)=CC=C12 | 
                                    
| CAS DataBase Reference | 196597-78-1(CAS DataBase Reference) | 
                                    
Description and Uses
A tricyclic indan derivative as receptor agonist; a therapeutic agent for sleep disorders.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P264-P270-P301+P312-P330-P501 | 
| HS Code | 2932.99.7000 | 
| HazardClass | IRRITANT | 

![6,7-Dihydro-1<i>H</i>-indeno[5,4-<i>b</i>]furan-8(2<i>H</i>)-one](https://img.chemicalbook.com/CAS/GIF/196597-78-1.gif)



![2-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine](https://img.chemicalbook.com/CAS/GIF/448964-37-2.gif)

![(R)-2-(2,6,7,8-tetrahydro-1H-indeno[5,4-b]furan-8-yl)acetic acid](https://img.chemicalbook.com/CAS/GIF/1092507-02-2.gif)