A3486312
4,4'-Diaminodiphenylamine Sulfate Hydrate , >97.0%(T) , 53760-27-3
CAS NO.：53760-27-3
Empirical Formula: C12H13N3.H2SO4
Molecular Weight: 297.32
MDL number: MFCD00013113
EINECS: 258-748-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB64.80 | In Stock |
|
| 25G | RMB188.80 | In Stock |
|
| 100G | RMB683.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4) |
| InChIKey | OOZQLPDAELLDNY-UHFFFAOYSA-N |
| SMILES | S(O)(=O)(=O)O.C1(C=CC(N)=CC=1)NC1=CC=C(N)C=C1 |
| CAS DataBase Reference | 53760-27-3(CAS DataBase Reference) |
Description and Uses
4,4'-Diaminodiphenylamine Sulfate Hydrate is a compound used in anti-corrosive coating material for the prevention of corrosion in metals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2921199990 |
