A3496012
(+)-Dibenzoyl-<small>D</small>-tartaric Acid , >98.0%(HPLC) , 17026-42-5
Synonym(s):
(+)-O,O′-Dibenzoyl-D -tartaric acid;(2S,3S)-(+)-Di-O-benzoyltartaric acid;D -Tartaric acid 2,3-dibenzoate;Di-O-benzoyl-D-tartaric acid
CAS NO.:17026-42-5
Empirical Formula: C18H14O8
Molecular Weight: 358.3
MDL number: MFCD00063222
EINECS: 241-097-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB27.20 | In Stock |
|
| 100G | RMB64.00 | In Stock |
|
| 250G | RMB119.20 | In Stock |
|
| 500G | RMB213.60 | In Stock |
|
| 1kg | RMB417.60 | In Stock |
|
| 5kg | RMB1569.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-156 °C(lit.) |
| Boiling point: | 450.75°C (rough estimate) |
| alpha | 120 º (c=5, MeOH) |
| Density | 1.3806 (rough estimate) |
| bulk density | 510kg/m3 |
| refractive index | 1.5500 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Acetonitrile (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 1.85±0.25(Predicted) |
| form | Powder |
| color | White to yellow |
| optical activity | [α]28/D +116°, c = 9 in ethanol |
| Water Solubility | insoluble |
| Sensitive | Hygroscopic |
| BRN | 2227343 |
| InChI | 1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/t13-,14-/m0/s1 |
| InChIKey | YONLFQNRGZXBBF-KBPBESRZSA-N |
| SMILES | OC(=O)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c2ccccc2)C(O)=O |
| CAS DataBase Reference | 17026-42-5(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-bis(benzoyloxy)-, (2S,3S)- (17026-42-5) |
Description and Uses
(+)-Dibenzoyl-D-tartaric acid is a reagent used to produce chiral salts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280i-P305+P351+P338-P337+P313-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |



