A3512212
2,5-Dimethyl-3-furancarboxylic Acid , >98.0%(GC) , 636-44-2
Synonym(s):
2,5-Dimethyl-3-furancarboxylic acid
CAS NO.：636-44-2
Empirical Formula: C7H8O3
Molecular Weight: 140.14
MDL number: MFCD00082181
EINECS: 211-257-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB188.80 | In Stock |
|
| 5G | RMB712.80 | In Stock |
|
| 25g | RMB2495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-140 °C (lit.) |
| Boiling point: | 240.6±35.0 °C(Predicted) |
| Density | 1.194±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 4.56±0.26(Predicted) |
| form | powder to crystaline |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9) |
| InChIKey | CNTHHNPBADVTRY-UHFFFAOYSA-N |
| SMILES | O1C(C)=CC(C(O)=O)=C1C |
| CAS DataBase Reference | 636-44-2(CAS DataBase Reference) |
Description and Uses
2,5-Dimethyl-3-furoic acid may be used as carboxylato ligand in the preparation of the following titanocene complexes:
- [Ti(η5-C5H5)2(OOC-dmf)2]
- [Ti(η5-C5H4Me)2(OOC-dmf)2]
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
