A3517312
1,2-Dihydronaphthalene , >98.0%(GC) , 447-53-0
Synonym(s):
Dialin
CAS NO.：447-53-0
Empirical Formula: C10H10
Molecular Weight: 130.19
MDL number: MFCD00001672
EINECS: 207-183-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB164.00 | In Stock |
|
| 100g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −8 °C(lit.) |
| Boiling point: | 89 °C16 mm Hg(lit.) |
| Density | 0.997 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 153 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Colorless to Light yellow |
| Water Solubility | Not miscible or difficult to mix with water. |
| BRN | 1851372 |
| InChI | InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| InChIKey | KEIFWROAQVVDBN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C=CC1 |
| CAS DataBase Reference | 447-53-0(CAS DataBase Reference) |
| EPA Substance Registry System | Naphthalene, 1,2-dihydro- (447-53-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | QJ4375000 |
| HS Code | 29029000 |
