A3517412
9,10-Dihydroanthracene , >98.0%(GC) , 613-31-0
CAS NO.：613-31-0
Empirical Formula: C14H12
Molecular Weight: 180.25
MDL number: MFCD00001239
EINECS: 210-336-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB151.20 | In Stock |
|
| 25G | RMB527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-107 °C (lit.) |
| Boiling point: | 312 °C (lit.) |
| Density | 0.88 g/mL at 25 °C (lit.) |
| refractive index | 1.6415 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 1.332mg/L(24.59 ºC) |
| BRN | 1364575 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
| InChIKey | WPDAVTSOEQEGMS-UHFFFAOYSA-N |
| SMILES | C1=C2C(CC3=C(C2)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 613-31-0(CAS DataBase Reference) |
| EPA Substance Registry System | Anthracene, 9,10-dihydro- (613-31-0) |
Description and Uses
9,10-Dihydroanthracene(DHA) has been used in a study to assess the hydrogen abstraction capability of valence-delocalized iron complex with DHA in MeCN.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H400 |
| Precautionary statements | P273 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2902.90.9000 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |
| Excepted Quantities | Non-Hazardous |
