A3519812
1,4-Di-<i>tert</i>-butylbenzene , >98.0% , 1012-72-2
CAS NO.:1012-72-2
Empirical Formula: C14H22
Molecular Weight: 190.32
MDL number: MFCD00008836
EINECS: 213-790-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB49.60 | In Stock |
|
| 5G | RMB129.60 | In Stock |
|
| 25G | RMB493.60 | In Stock |
|
| 100G | RMB1711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 236 °C(lit.) |
| Density | 0.985 |
| refractive index | 1.4955 (estimate) |
| Flash point: | 236°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystalline |
| color | white |
| Water Solubility | Insoluble in water. Soluble in ethanol, benzene, carbon tetrachloride. |
| BRN | 1617000 |
| InChI | 1S/C14H22/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6/h7-10H,1-6H3 |
| InChIKey | OOWNNCMFKFBNOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)C(C)(C)C |
| CAS DataBase Reference | 1012-72-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,4-bis(1,1-dimethylethyl)-(1012-72-2) |
| EPA Substance Registry System | p-Di-tert-butylbenzene (1012-72-2) |
Description and Uses
1,4-di-tert-butylbenzene (DTBB) is crystallized from several organic solvents to study the effect of solvents and crystallization conditions on its habit.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 22-24/25-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | CY8444000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




