A3523412
2,5-Dimethyl-1,4-phenylenediamine , 98% , 6393-01-7
Synonym(s):
2,5-Dimethyl-p -phenylenediamine;2,5-Dimethyl-1,4-diaminobenzene
CAS NO.:6393-01-7
Empirical Formula: C8H12N2
Molecular Weight: 136.19
MDL number: MFCD00052675
EINECS: 229-003-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25G | RMB133.60 | In Stock |
|
| 100G | RMB420.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-150 °C (lit.) |
| Boiling point: | 281.1±35.0 °C(Predicted) |
| Density | 1.076±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), DMSO (Slightly) |
| pka | 6.14±0.10(Predicted) |
| form | Solid |
| color | Brown to Dark Beige |
| InChI | InChI=1S/C8H12N2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,9-10H2,1-2H3 |
| InChIKey | BWAPJIHJXDYDPW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C)=C(N)C=C1C |
| CAS DataBase Reference | 6393-01-7(CAS DataBase Reference) |
Description and Uses
2,5-Dimethyl-1,4-phenylenediamine (cas# 6393-01-7) is a useful reagent for synthesis of novel Schiff-?base type conjugative polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



