A3524112
4,4'-Diaminostilbene-2,2'-disulfonic Acid , 94% , 81-11-8
Synonym(s):
Amsonic acid
CAS NO.:81-11-8
Empirical Formula: C14H14N2O6S2
Molecular Weight: 370.4
MDL number: MFCD00024946
EINECS: 201-325-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB45.60 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 500G | RMB412.00 | In Stock |
|
| 2.5kg | RMB1261.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Density | 1.4732 (rough estimate) |
| vapor pressure | 1.3hPa at 25℃ |
| refractive index | 1.6510 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Base (Slightly) |
| pka | -1.58±0.50(Predicted) |
| form | Crystalline Powder |
| color | Cream to yellow-brown |
| Water Solubility | <0.1 g/100 mL at 23 ºC |
| Merck | 14,595 |
| BRN | 629516 |
| Stability: | Stable. Combustible. Incompatible with iron, strong oxidizing agents. |
| InChI | 1S/C14H14N2O6S2/c15-11-5-3-9(13(7-11)23(17,18)19)1-2-10-4-6-12(16)8-14(10)24(20,21)22/h1-8H,15-16H2,(H,17,18,19)(H,20,21,22)/b2-1+ |
| InChIKey | REJHVSOVQBJEBF-OWOJBTEDSA-N |
| SMILES | Nc1ccc(\C=C\c2ccc(N)cc2S(O)(=O)=O)c(c1)S(O)(=O)=O |
| LogP | -1.7--1.42 at 25℃ |
| CAS DataBase Reference | 81-11-8(CAS DataBase Reference) |
| EPA Substance Registry System | Amsonic acid (81-11-8) |
Description and Uses
4,4’-Diaminostilbene-2,2’-disulfonic Acid, 95+% (cas# 81-11-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | C,Xn |
| Risk Statements | 34-22-36/37/38-20/21/22 |
| Safety Statements | 24/25-45-36/37/39-26-22 |
| RIDADR | UN 2583 |
| WGK Germany | WGK 1 |
| RTECS | WJ6603000 |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 81-11-8(Hazardous Substances Data) |



