A3525512
9,10-Dicyanoanthracene , 98% , 1217-45-4
Synonym(s):
9,10-Dicyanoanthracene
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB111.20 | In Stock |
|
| 250MG | RMB120.00 | In Stock |
|
| 1G | RMB236.00 | In Stock |
|
| 5G | RMB944.00 | In Stock |
|
| 25G | RMB3824.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 340 °C(lit.) |
| Boiling point: | 360.06°C (rough estimate) |
| Density | 1.2027 (rough estimate) |
| refractive index | 1.5635 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Yellow |
| BRN | 1646384 |
| InChI | InChI=1S/C16H8N2/c17-9-15-11-5-1-2-6-12(11)16(10-18)14-8-4-3-7-13(14)15/h1-8H |
| InChIKey | BIOPPFDHKHWJIA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(C#N)=C3C(=C2C#N)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 1217-45-4(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedicarbonitrile (1217-45-4) |
Description and Uses
9,10-Anthracenedicarbonitrile may be used as photosensitizer to investigate the photoisomerization of trans-stilbene (TS) in sodium dodecyl sulfate (SDS)/benzyl alcohol (BA)/H2O system.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |








