A3531412
7,8-Dimethylalloxazine , >95.0%(HPLC) , 1086-80-2
Synonym(s):
7,8-Dimethylalloxazine
CAS NO.:1086-80-2
Empirical Formula: C12H10N4O2
Molecular Weight: 242.23
MDL number: MFCD00005021
EINECS: 214-120-8
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB31.20 | In Stock |
|
| 100MG | RMB151.20 | In Stock |
|
| 250mg | RMB319.20 | In Stock |
|
| 1g | RMB719.20 | In Stock |
|
| 5g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 385.06°C (rough estimate) |
| Density | 1.2532 (rough estimate) |
| refractive index | 1.6081 (estimate) |
| storage temp. | Refrigerator |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated) |
| pka | 10.02±0.70(Predicted) |
| form | Solid |
| color | Pale Yellow to Yellow |
| λmax | 350 nm 392 nm (2nd) |
| Merck | 13,5620 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3NC(=O)NC(=O)c3nc2cc1C |
| CAS DataBase Reference | 1086-80-2(CAS DataBase Reference) |
Description and Uses
Lumichrome is a derivative of Riboflavin (R415000), a vitamin with a key role in maintaining cellular function and health in human and animals. Dyes and metabolites.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2933.99.8210 |
| Storage Class | 11 - Combustible Solids |






