A3532812
Diethyl (<i>p</i>-Toluenesulfonyloxymethyl)phosphonate , >97.0%(GC) , 31618-90-3
CAS NO.：31618-90-3
Empirical Formula: C12H19O6PS
Molecular Weight: 322.31
MDL number: MFCD03412078
EINECS: 608-653-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB74.40 | In Stock |
|
| 500G | RMB243.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 137°C/0.02mmHg(lit.) |
| Density | 1.255 |
| refractive index | 1.4980 to 1.5020 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Sparingly), Dichloromethane, Ethyl Acetate, Methanol (Sparingly) |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| InChI | InChI=1S/C12H19O6PS/c1-4-16-19(13,17-5-2)10-18-20(14,15)12-8-6-11(3)7-9-12/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | UOEFFQWLRUBDME-UHFFFAOYSA-N |
| SMILES | P(COS(C1=CC=C(C)C=C1)(=O)=O)(=O)(OCC)OCC |
| CAS DataBase Reference | 31618-90-3(CAS DataBase Reference) |
Description and Uses
Diethyl p-Toluenesulfonyloxymethylphosphonate is an antiviral agent and a Tenofovir (T018500) intermediate. Tenofovir is an acyclic phosphonate nucleotide analogue and reverse transcriptase inhibitor used as an anti-HIV agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39 |
| HS Code | 29309090 |
