A3539212
2,6-Dichlorofluorobenzene , >98.0%(GC) , 2268-05-5
CAS NO.:2268-05-5
Empirical Formula: C6H3Cl2F
Molecular Weight: 164.99
MDL number: MFCD00010307
EINECS: 607-128-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1g | RMB23.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB142.40 | In Stock |
|
| 500g | RMB666.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-40 °C(lit.) |
| Boiling point: | 168-169 °C(lit.) |
| Density | 1.3967 (estimate) |
| Flash point: | 140 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 1862513 |
| InChI | InChI=1S/C6H3Cl2F/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | JORVCRLRRRRLFI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 2268-05-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dichloro-2-fluorobenzene(2268-05-5) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




