A3544012
Decyltrimethoxysilane , >97.0%(GC) , 5575-48-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB45.60 | In Stock |
|
| 25G | RMB176.00 | In Stock |
|
| 100G | RMB620.80 | In Stock |
|
| 500G | RMB2448.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -37°C |
| Boiling point: | 115 °C |
| Density | 0.9 |
| vapor pressure | 1hPa at 20℃ |
| refractive index | 1.4220 |
| Flash point: | 117°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| Specific Gravity | 0.9 |
| color | Colorless to Almost colorless |
| Water Solubility | Soluble in organic solvents. Insoluble in water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 8625082 |
| InChI | InChI=1S/C13H30O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4/h5-13H2,1-4H3 |
| InChIKey | KQAHMVLQCSALSX-UHFFFAOYSA-N |
| SMILES | [Si](CCCCCCCCCC)(OC)(OC)OC |
| LogP | 3.75 at 25℃ |
Description and Uses
n-Decyltrimethoxysilane is used as a coupling agent and as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Risk Statements | 36/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2931.90.9010 |
