PRODUCT Properties
| Melting point: | 95-99 °C (lit.) |
| Boiling point: | 237.3±35.0 °C(Predicted) |
| Density | 1.099±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 16.23±0.50(Predicted) |
| color | Light Brown |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H9NO/c1-5-3-6(2)8-7(5)4-9/h3-4,8H,1-2H3 |
| InChIKey | RDFZYUOHJBXMJA-UHFFFAOYSA-N |
| SMILES | N1C(C)=CC(C)=C1C=O |
| CAS DataBase Reference | 2199-58-8(CAS DataBase Reference) |
Description and Uses
3,5-Dimethyl-1H-pyrrole-2-carboxaldehyde is an intermediate used in the synthesis of a series of anaplastic lymphoma kinase (ALK) inhibitors, a new target for therapy of non-small-cell lung cancer (NSCLC).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




