A3557912
2,3-Dibromopropionic Acid , >97.0% , 600-05-5
CAS NO.:600-05-5
Empirical Formula: C3H4Br2O2
Molecular Weight: 231.87
MDL number: MFCD00004212
EINECS: 209-981-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB69.60 | In Stock |
|
| 100g | RMB119.20 | In Stock |
|
| 500G | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C (lit.) |
| Boiling point: | 160 °C/20 mmHg (lit.) |
| Density | 2.0803 (rough estimate) |
| refractive index | 1.5220 (estimate) |
| Flash point: | -33℃ |
| storage temp. | 2-8°C |
| pka | pK1:2.33 (25°C) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | very faint turbidity |
| BRN | 1721428 |
| Major Application | environmental |
| InChI | InChI=1S/C3H4Br2O2/c4-1-2(5)3(6)7/h2H,1H2,(H,6,7) |
| InChIKey | ZMYAKSMZTVWUJB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Br)CBr |
| CAS DataBase Reference | 600-05-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2,3-dibromo-(600-05-5) |
| EPA Substance Registry System | 2,3-Dibromopropionic acid (600-05-5) |
Description and Uses
2,3-Dibromopropionic acid was used in chemical shift imaging during analysis of multiple samples by multiplex sample NMR methodology. It was used as surrogate standard during extraction and determination of haloacetic acid in drinking water.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xi,F |
| Risk Statements | 34-40-36/37/38-38-11 |
| Safety Statements | 26-36/37/39-45-36-16-24-9 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | UF0660000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






