A3565212
2,6-Di-<i>tert</i>-butyl-4-methoxyphenol [Oxidation inhibitor] , >98.0%(GC) , 489-01-0
Synonym(s):
3,5-Di-tert-butyl-4-hydroxyanisole
CAS NO.:489-01-0
Empirical Formula: C15H24O2
Molecular Weight: 236.35
MDL number: MFCD00008824
EINECS: 207-693-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-106 °C (lit.) |
| Boiling point: | 135-140°C 10mm |
| Density | 0.9845 (rough estimate) |
| refractive index | 1.5542 (estimate) |
| Flash point: | 135-140°C/10mm |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | Liquid |
| pka | 13.04±0.40(Predicted) |
| color | Clear |
| BRN | 2052290 |
| InChI | InChI=1S/C15H24O2/c1-14(2,3)11-8-10(17-7)9-12(13(11)16)15(4,5)6/h8-9,16H,1-7H3 |
| InChIKey | SLUKQUGVTITNSY-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(OC)C=C1C(C)(C)C |
| CAS DataBase Reference | 489-01-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,6-Di-tert-butyl-4-methoxyphenol (489-01-0) |
Description and Uses
2,6-Di-tert-butyl-4-methoxyphenol has been used to protect cosmetics, drugs and foods from oxidative degradation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | SJ7785668 |
| Hazard Note | Irritant |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![2,6-Di-<i>tert</i>-butyl-4-methoxyphenol [Oxidation inhibitor]](https://img.chemicalbook.com/CAS/GIF/489-01-0.gif)





