A3582212
Diisobutyldimethoxysilane , >97.0% , 17980-32-4
CAS NO.:17980-32-4
Empirical Formula: C10H24O2Si
Molecular Weight: 204.38
MDL number: MFCD00236510
EINECS: 605-870-0
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB44.80 | In Stock |
|
| 5ML | RMB135.20 | In Stock |
|
| 25ML | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-78°C |
| Boiling point: | 120 °C |
| Density | 0.87 |
| vapor pressure | 0.75 hPa ( 25 °C) |
| refractive index | 1.4235-1.4255 |
| Flash point: | 76°C |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.87 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 2636371 |
| InChI | 1S/C10H24O2Si/c1-9(2)7-13(11-5,12-6)8-10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | NHYFIJRXGOQNFS-UHFFFAOYSA-N |
| SMILES | [Si](OC)(OC)(CC(C)C)CC(C)C |
| CAS DataBase Reference | 17980-32-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, dimethoxybis(2-methylpropyl)- (17980-32-4) |
Description and Uses
Diisobutyldimethoxysilane is a colorless, transparent liquid used as a catalyst in propylene polymerization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338-P321-P332+P313-P362 |
| Risk Statements | 51/53-36/38 |
| Safety Statements | 36/37/39-45-26/36 |
| RIDADR | 3082 |
| WGK Germany | WGK 2 |
| Autoignition Temperature | 255°C |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |




