A3585712
5'-Deoxy-5-fluorouridine , >98.0%(HPLC) , 3094-09-5
Synonym(s):
5′dFUrd;5-Fluoro-5′-deoxyuridine;Doxifluridine
CAS NO.:3094-09-5
Empirical Formula: C9H11FN2O5
Molecular Weight: 246.19
MDL number: MFCD00866530
EINECS: 221-440-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB72.00 | In Stock |
|
| 5G | RMB190.40 | In Stock |
|
| 25g | RMB623.20 | In Stock |
|
| 100g | RMB1996.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-192 °C(lit.) |
| alpha | D25 +18.4° (c = 0.419 in water) |
| Density | 1.3751 (estimate) |
| refractive index | 20 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.4(at 25℃) |
| color | White |
| Merck | 14,3437 |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C9H11FN2O5/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16/h2-3,5-6,8,13-14H,1H3,(H,11,15,16)/t3-,5-,6-,8-/m1/s1 |
| InChIKey | ZWAOHEXOSAUJHY-ZIYNGMLESA-N |
| SMILES | C[C@H]1O[C@@H](N2C=C(F)C(=O)NC2=O)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 3094-09-5(CAS DataBase Reference) |
Description and Uses
Doxifluridine is a prodrug derivative of 5-fluorouracil (5-FU). As an antineoplastic it is more potent than 5-FU in the treatment of breast, stomach, colon and rectal cancers.
antineoplastic, pyrimidine antimetabolite
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352+P333+P313+P363-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 2 |
| RTECS | YU7526000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 (14 day) in mice or rats (mg/kg): >1000 i.v.: >2000 s.c.; in male, female mice, male, female rats (mg/kg): >5000, >5000, 3471, 3390 orally (Shimizu) |






![5'-Deoxy-5-fluoro-N-[(pentyloxy)carbonyl]cytidine 2',3'-diacetate](https://img.chemicalbook.com/CAS/GIF/162204-20-8.gif)
