A3598212
Dibutyl Itaconate , 97%, including stabilizer HQ , 2155-60-4
Synonym(s):
2-Methylenebutanedioic acid1,4-dibutyl ester;Di(n -butyl) itaconate;Dibutyl itaconate
CAS NO.:2155-60-4
Empirical Formula: C13H22O4
Molecular Weight: 242.31
MDL number: MFCD00027211
EINECS: 218-451-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB70.40 | In Stock |
|
| 100G | RMB145.60 | In Stock |
|
| 500G | RMB371.20 | In Stock |
|
| 2.5KG | RMB1198.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 284 °C(lit.) |
| Density | 0.985 g/mL at 25 °C(lit.) |
| vapor pressure | 0.19Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.985 |
| Water Solubility | 74.8mg/L at 20℃ |
| InChI | InChI=1S/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
| InChIKey | OGVXYCDTRMDYOG-UHFFFAOYSA-N |
| SMILES | C(OCCCC)(=O)C(=C)CC(OCCCC)=O |
| LogP | 3.8 at 20℃ |
| CAS DataBase Reference | 2155-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, methylene-, dibutyl ester (2155-60-4) |
Description and Uses
DBI is a monomer that can be copolymerized with pyridine groups to form nanocomposites for the development of bio-based elastomers. Copolymerization of DBI with acrylated epoxidized soya oil (AESO) can produce a thermoset material which finds potential applications in the modification of fatty acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |




