![2-[2-(Diethylamino)ethoxy]ethanol](https://img.chemicalbook.com/CAS/GIF/140-82-9.gif)
A3600612
2-[2-(Diethylamino)ethoxy]ethanol , >98.0%(GC) , 140-82-9
CAS NO.：140-82-9
Empirical Formula: C8H19NO2
Molecular Weight: 161.24
MDL number: MFCD00020604
EINECS: 205-436-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB416.80 | In Stock |
|
| 500G | RMB955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 101°C 1mm |
| Density | 0,94 g/cm3 |
| refractive index | 1.4470-1.4500 |
| Flash point: | 96°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| pka | 14.39±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H19NO2/c1-3-9(4-2)5-7-11-8-6-10/h10H,3-8H2,1-2H3 |
| InChIKey | VKBVRNHODPFVHK-UHFFFAOYSA-N |
| SMILES | C(O)COCCN(CC)CC |
| CAS DataBase Reference | 140-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(2-Diethylaminoethoxy)-ethanol(140-82-9) |
| EPA Substance Registry System | 2-[2-(Diethylamino)ethoxy]ethanol (140-82-9) |
Description and Uses
A metabolite of Butamirate; also a degradation product of Oxeladin citrate (OL) and Oxybutynin hydrochloride (OB).
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-24/25-45-36/37/39-26 |
| HS Code | 2922500090 |
| Toxicity | rabbit,LD50,skin,2020uL/kg (2.02mL/kg),LIVER: OTHER CHANGESGASTROINTESTINAL: OTHER CHANGESSKIN AND APPENDAGES (SKIN): "DERMATITIS, OTHER: AFTER SYSTEMIC EXPOSURE",National Technical Information Service. Vol. OTS0535166, |
