A3601912
2,6-Diphenylphenol , >98.0% , 2432-11-3
CAS NO.：2432-11-3
Empirical Formula: C18H14O
Molecular Weight: 246.3
MDL number: MFCD00009716
EINECS: 219-401-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB291.20 | In Stock |
|
| 100G | RMB1087.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103 °C (lit.) |
| Boiling point: | 349.31°C (rough estimate) |
| Density | 1.0572 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.02±0.10(Predicted) |
| form | Crystals or Powder |
| color | White to off-white |
| BRN | 2051224 |
| InChI | InChI=1S/C18H14O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13,19H |
| InChIKey | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC(C3=CC=CC=C3)=C2O)=CC=CC=C1 |
| CAS DataBase Reference | 2432-11-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Diphenyl phenol(2432-11-3) |
Description and Uses
2,6-Diphenylphenol has been used:
- as ligand during the synthesis of reduced coordination (less than 6), unchelated manganese oxygen cluster systems
- in the preparation of derivatives of pyrazine-2,3-dicarbonitrile, precursor required for the synthesis of octaazaphthalocyanine (AzaPc) derivatives
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29071990 |
