A3606612
6,7-Dimethoxy-3,4-dihydroisoquinoline Hydrochloride , >98.0%(HPLC) , 20232-39-7
CAS NO.:20232-39-7
Empirical Formula: C11H14ClNO2
Molecular Weight: 227.69
MDL number: MFCD00143492
EINECS: 606-469-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB161.60 | In Stock |
|
| 25g | RMB432.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-202 °C |
| RTECS | NW7625000 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale yellow |
| Water Solubility | soluble |
| InChI | InChI=1S/C11H13NO2.ClH/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2;/h5-7H,3-4H2,1-2H3;1H |
| InChIKey | PQXVEYYRJHMTEV-UHFFFAOYSA-N |
| SMILES | C12CCN=CC=1C=C(OC)C(OC)=C2.Cl |
Description and Uses
6,7-Dimethoxy-3,4-dihydroisoquinoline hydrochloride is used in the synthesis of Tetrabenazine (T284000).






