A3608512
4,6-Dimethoxysalicylaldehyde , >98.0%(GC) , 708-76-9
Synonym(s):
2,4-Dimethoxy-6-hydroxybenzaldehyde;4,6-Dimethoxy-2-hydroxybenzaldehyde
CAS NO.：708-76-9
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00003328
EINECS: 211-904-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB81.36 | In Stock |
|
| 5G | RMB265.60 | In Stock |
|
| 25g | RMB952.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70 °C (lit.) |
| Boiling point: | 131°C/0.05mmHg(lit.) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.42±0.15(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1241679 |
| InChI | InChI=1S/C9H10O4/c1-12-6-3-8(11)7(5-10)9(4-6)13-2/h3-5,11H,1-2H3 |
| InChIKey | FQRQWPNYJOFDLO-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(OC)C=C(OC)C=C1O |
| CAS DataBase Reference | 708-76-9(CAS DataBase Reference) |
Description and Uses
4,6-Dimethoxysalicylaldehyde was used in the preparation of a new class of efficient ketocoumarin triplet sensitizers. It was used as staring reagent in the total synthesis of (+/-)-linderol A, a hexahydrodibenzofuran.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| F | 9-23 |
| Hazard Note | Harmful/Store Cold |
| HS Code | 2912490090 |
