PRODUCT Properties
| Melting point: | 167-172°C |
| Boiling point: | bp2.0 150-165° |
| Density | 0.9889 (rough estimate) |
| refractive index | 1.5450 to 1.5490 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | pKa 9.1 (Uncertain) |
| color | Oil |
| Merck | 14,3309 |
| BCS Class | 1 |
| InChI | InChI=1S/C17H21NO/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | ZZVUWRFHKOJYTH-UHFFFAOYSA-N |
| SMILES | C(N(C)C)COC(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 58-73-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethylamine, 2-diphenylmethoxy-n,n-dimethyl-(58-73-1) |
| EPA Substance Registry System | Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl- (58-73-1) |
Description and Uses
Diphenhydramine is one of the main representatives of antihistamine drugs that block H1 receptors. Besides antihistamine activity, diphenhydramine exhibits a local anesthetic effect, relaxes smooth muscle, and has sedative and soporific action.
Antihistaminic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| RTECS | KR6825000 |
| TSCA | TSCA listed |
| HS Code | 2922.19.7000 |
| Hazardous Substances Data | 58-73-1(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 390mg/kg |



![2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amine](https://img.chemicalbook.com/CAS/GIF/19804-27-4.gif)



![N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine](https://img.chemicalbook.com/CAS/20180601/GIF/21945-86-8.gif)