A3644912
1,1′-Diethylferrocene , 98% , 1273-97-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB124.00 | In Stock |
|
| 5G | RMB412.00 | In Stock |
|
| 10g | RMB1076.80 | In Stock |
|
| 25g | RMB1333.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 284 °C(lit.) |
| Density | 1.18 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| color | orange |
| Specific Gravity | 1.180 |
| Water Solubility | Insoluble |
| InChI | InChI=1S/2C7H9.Fe/c2*1-2-7-5-3-4-6-7;/h2*3-6H,2H2,1H3; |
| InChIKey | GKKLDIHVIQZCPZ-UHFFFAOYSA-N |
| SMILES | [C]1(CC)[CH][CH][CH][CH]1.[C]1(CC)[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,10,11,12,13| |
| CAS DataBase Reference | 1273-97-8 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29310099 |
| Toxicity | mammal (species unspecified),LC,inhalation,> 26mg/m3 (26mg/m3),BRAIN AND COVERINGS: RECORDINGS FROM SPECIFIC AREAS OF CNSCARDIAC: OTHER CHANGESLIVER: LIVER FUNCTION TESTS IMPAIRED,"Spravochnik po Toksikologii i Gigienicheskim Normativam Vol. -, Pg. 28, 1999. |





![(R,R)-(+)-2,2''-Bis[(S)-(N,N-dimethylamino)(phenyl)methyl]-1,1''-bis(di(2-methylphenyl)phosphino)ferrocene](https://img.chemicalbook.com/CAS/GIF/831226-39-2.gif)

![(1R,1'R)-1,1'-Bis[bis(3,5-dimethylphenyl)phosphino]-2,2'-bis[(R)-(dimethylamino)phenylmethyl]ferrocene](https://img.chemicalbook.com/CAS/GIF/793718-16-8.gif)