A3653012
1-<WBR>Decyl-<WBR>3-<WBR>methylimidazolium chloride , 95% , 171058-18-7
Synonym(s):
[C10MIM][Cl]
CAS NO.：171058-18-7
Empirical Formula: C14H27ClN2
Molecular Weight: 258.83
MDL number: MFCD03427605
EINECS: 200-145-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25g | RMB214.40 | In Stock |
|
| 50G | RMB423.20 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38.02 °C |
| Density | 0.99 g/cm3 (25 °C) |
| refractive index | n20/D 1.501 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light yellow to Brown |
| InChI | 1S/C14H27N2.ClH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-14H,3-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HTZVLLVRJHAJJF-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCCCCn1cc[n+](C)c1 |
| CAS DataBase Reference | 171058-18-7 |
Description and Uses
1-Decyl-3-methylimidazolium chloride can be used in the preparation of 1-decyl-3-methylimidazolium triflate by reacting with sodium triflate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 2933.29.9000 |
| Storage Class | 10 - Combustible liquids |
