A3661712
2,2′-Dichlorobenzil , 97% , 21854-95-5
CAS NO.:21854-95-5
Empirical Formula: C14H8Cl2O2
Molecular Weight: 279.12
MDL number: MFCD00018263
EINECS: 627-448-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-136 °C (lit.) |
| Boiling point: | 426.9±30.0 °C(Predicted) |
| Density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | solid |
| Appearance | Light yellow to green yellow Solid |
| BRN | 2120689 |
| InChI | InChI=1S/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H |
| InChIKey | VOSNNSVWVJFJCR-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1Cl)(=O)C(C1=CC=CC=C1Cl)=O |
| CAS DataBase Reference | 21854-95-5 |
| EPA Substance Registry System | Ethanedione, bis(2-chlorophenyl)- (21854-95-5) |
Description and Uses
1,2-Bis(2-chlorophenyl)-1,2-ethanedione is a key intermediate in the synthesis of substituted benzils and analogs with biological and pharmacological properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H400 |
| Precautionary statements | P273-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36-50/53 |
| Safety Statements | 26-36-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 |




