A3667612
3,5-Dinitro-<I>o</I>-toluic acid , 98% , 28169-46-2
CAS NO.:28169-46-2
Empirical Formula: C8H6N2O6
Molecular Weight: 226.14
MDL number: MFCD00007161
EINECS: 248-880-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB40.80 | In Stock |
|
| 100G | RMB86.40 | In Stock |
|
| 500g | RMB314.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207 °C(lit.) |
| Boiling point: | 367.74°C (rough estimate) |
| Density | 1.6136 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| pka | pK1:2.97 (25°C) |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water. |
| BRN | 2622906 |
| InChI | InChI=1S/C8H6N2O6/c1-4-6(8(11)12)2-5(9(13)14)3-7(4)10(15)16/h2-3H,1H3,(H,11,12) |
| InChIKey | CDVNZMKTJIBBBV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 28169-46-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-methyl-3,5-dinitro- (28169-46-2) |
Description and Uses
2-Methyl-3,5-dinitrobenzoic acid was used to synthesis heterocyclic derivatives and in the synthesis of isoquinolone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




