A3674812
2,6-<WBR>Diisopropylphenylboronic acid , 97% , 363166-79-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB390.40 | In Stock |
|
| 1G | RMB827.20 | In Stock |
|
| 5g | RMB2482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-172°C |
| Boiling point: | 327.5±52.0 °C(Predicted) |
| Density | 0.99±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | 8.74±0.58(Predicted) |
| color | Pale yellow |
| InChI | InChI=1S/C12H19BO2/c1-8(2)10-6-5-7-11(9(3)4)12(10)13(14)15/h5-9,14-15H,1-4H3 |
| InChIKey | UPXGMXMTUMCLGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(C)C)C=CC=C1C(C)C)(O)O |
Description and Uses
2,6-Diisopropylphenylboronic acid can be used as a reactant:
- In the Pd-catalyzed Suzuki-Miyaura cross-coupling reactions.
- To synthesis potent propargyl-based inhibitors of the Cryptosporidium dihydrofolate reductase (DHFR) enzyme.
- To prepare boralumoxane applicable in the activation of zirconocene catalyst for the polymerization ethene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | nwg |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |