A3675112
3,4-<WBR>Dimethoxyphenylboronic acid, pinacol ester , 98% , 365564-10-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1G | RMB82.40 | In Stock |
|
| 5g | RMB344.16 | In Stock |
|
| 25g | RMB892.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-87°C |
| Boiling point: | 352.5±32.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C14H21BO4/c1-13(2)14(3,4)19-15(18-13)10-7-8-11(16-5)12(9-10)17-6/h7-9H,1-6H3 |
| InChIKey | QPWUFMRNTUHMJD-UHFFFAOYSA-N |
| SMILES | B2(OC(C(O2)(C)C)(C)C)c1cc(c(cc1)OC)OC |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-36 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,1'-biphenyl]-4-carbonitrile](https://img.chemicalbook.com/CAS2/GIF/406482-72-2.gif)


