A3686812
Diisopentyl phthalate , 95.0%(GC) , 605-50-5
CAS NO.：605-50-5
Empirical Formula: C18H26O4
Molecular Weight: 306.4
MDL number: MFCD00127736
EINECS: 210-088-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB79.20 | In Stock |
|
| 1g | RMB180.80 | In Stock |
|
| 5g | RMB656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 334 °C (decomp) |
| Boiling point: | bp40 225° |
| Density | 1.028 |
| vapor pressure | 0.025Pa at 25℃ |
| refractive index | 1.4871 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C18H26O4/c1-13(2)9-11-21-17(19)15-7-5-6-8-16(15)18(20)22-12-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | JANBFCARANRIKJ-UHFFFAOYSA-N |
| SMILES | C1(C(OCCC(C)C)=O)=CC=CC=C1C(OCCC(C)C)=O |
| LogP | 5.6 at 25℃ |
Description and Uses
Plasticizer for nitrocellulose and resin lacquers; preventing foam in manufacture of glue; in rubber cements.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 61-60-50/53 |
| Safety Statements | 53-61 |
| RIDADR | 3082 |
| HS Code | 29173410 |
