A3688012
Diethyl dibromomalonate , 97% , 631-22-1
CAS NO.:631-22-1
Empirical Formula: C7H10Br2O4
Molecular Weight: 317.96
MDL number: MFCD00015154
EINECS: 211-151-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB102.24 | In Stock |
|
| 25G | RMB204.80 | In Stock |
|
| 100g | RMB724.00 | In Stock |
|
| 500g | RMB2126.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140-143 °C/18 mmHg (lit.) |
| Density | 1.68 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | sol benzene, CCl4, DMSO, THF |
| form | liquid |
| color | Clear, light yellow |
| BRN | 1783879 |
| InChI | InChI=1S/C7H10Br2O4/c1-3-12-5(10)7(8,9)6(11)13-4-2/h3-4H2,1-2H3 |
| InChIKey | PFZYFZRUPFUEOB-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)(Br)C(OCC)=O |
| EPA Substance Registry System | Propanedioic acid, dibromo-, diethyl ester (631-22-1) |
Description and Uses
Diethyl dibromomalonate is used for selective bromination of polyunsaturated ester enolates; converts alkenes into cyclopropanes in the presence of suitable heavy metal reagents.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Risk Statements | 34 |
| Safety Statements | 20-26-36/37/39-45-60 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171900 |







