A3710212
2,6-dibromopyridine-4-carboxylic acid , 97% , 2016-99-1
CAS NO.：2016-99-1
Empirical Formula: C6H3Br2NO2
Molecular Weight: 280.9
MDL number: MFCD08741485
EINECS: 640-910-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB116.80 | In Stock |
|
| 5g | RMB380.80 | In Stock |
|
| 25g | RMB1624.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-185 °C(Solv: water (7732-18-5)) |
| Boiling point: | 487.5±45.0 °C(Predicted) |
| Density | 2.202±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 2.59±0.10(Predicted) |
| color | White to off white |
| InChI | InChI=1S/C6H3Br2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11) |
| InChIKey | AULQTVXAKNKCCA-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(Br)=CC(C(O)=O)=C1 |
Description and Uses
2,?6-?Dibromopyridine-?4-?carboxylic Acid is an analog of 2,6-Dichloroisonicotinic acid which binds and inhibits tobacco catalase activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| HS Code | 2933399990 |
