A3716312
1-(diphenylmethyl)azetidin-3-amine , 97% , 40432-52-8
CAS NO.：40432-52-8
Empirical Formula: C16H18N2
Molecular Weight: 238.33
MDL number: MFCD03093386
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB100.00 | In Stock |
|
| 5g | RMB200.00 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63 °C |
| Boiling point: | 339.2±42.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 8.48±0.20(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C16H18N2/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12,17H2 |
| InChIKey | LYTNNHXGUOKXFI-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(N)C1 |
| CAS DataBase Reference | 40432-52-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2933998090 |
