A3728612
2,5-dibromopyridin-3-amine , 97% , 90902-84-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB45.60 | In Stock |
|
| 1G | RMB111.20 | In Stock |
|
| 5g | RMB361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152.0 to 156.0 °C |
| Boiling point: | 325.0±37.0 °C(Predicted) |
| Density | 2.147±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -0.56±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C5H4Br2N2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 |
| InChIKey | VHGBUYMPBFPXQM-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Br)C=C1N |
| CAS DataBase Reference | 90902-84-4 |
Description and Uses
3-Amino-2,5-dibromopyridine is used as a pharmaceutical synthesis intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
