A3757412
2,5-Dichlorobenzophenone , 97% , 16611-67-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88°C |
| Boiling point: | 240-260 °C |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystals |
| color | Off-white to brown |
| InChI | InChI=1S/C13H8Cl2O/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H |
| InChIKey | FAVKIHMGRWRACA-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Cl)=CC=C1Cl)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 16611-67-9(CAS DataBase Reference) |
Description and Uses
2,5-Dichlorobenzophenones can be used as starting materials for general, pharmaceutical and polymer synthesis. For example, using such compounds to prepare substituted para-polyphenylenes should proceed readily by metal-catalyzed aryl coupling of the 2,5-dichlorophenyl group of these compounds. Polyphenylenes formed from these compounds will have pendant side groups comprising the carbonyl, and the aryl or pyridyl group bonded thereto.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H410 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P312-P330-P363-P403-P501c |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |




