A3779912
Dimethyl furan-2,5-dicarboxylate , 98% , 4282-32-0
CAS NO.:4282-32-0
Empirical Formula: C8H8O5
Molecular Weight: 184.15
MDL number: MFCD00092317
EINECS: 248-451-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100g | RMB871.20 | In Stock |
|
| 500g | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112°C |
| Boiling point: | 278.08°C (rough estimate) |
| Density | 1.3840 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | 2-8°C |
| form | crystals |
| color | White |
| InChI | InChI=1S/C8H8O5/c1-11-7(9)5-3-4-6(13-5)8(10)12-2/h3-4H,1-2H3 |
| InChIKey | UWQOPFRNDNVUOA-UHFFFAOYSA-N |
| SMILES | O1C(C(OC)=O)=CC=C1C(OC)=O |
Description and Uses
Dimethyl Furan-2,5-dicarboxylate is a structural analog of diacids. It has been synthesized by the reaction of 5-hydroxymethylfurfural with ethyl esters and phosphotungstic acid.
2,5-Furandicarboxylic acid dimethyl ester can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P261-P271-P280 |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |






