A3839312
1-(3,5-Dibromophenyl)ethanone , 97% , 14401-73-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB38.40 | In Stock |
|
| 1G | RMB84.80 | In Stock |
|
| 5g | RMB261.60 | In Stock |
|
| 25g | RMB900.00 | In Stock |
|
| 100g | RMB3196.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68°C |
| Boiling point: | 160-164 °C(Press: 1-2 Torr) |
| Density | 1.7855 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C8H6Br2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
| InChIKey | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Br)=CC(Br)=C1)C |
Description and Uses
3,5-Dibromoacetophenone is a halogenated acetophenone compound containing bromine functional groups at positions 3 and 5. It can be used with halogenated metal salts as raw materials to prepare a polyhalogenated thiazolinone compound.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2914500090 |






