A3848712
Diisopropyl hydrazine-1,2-dicarboxylate , 97% , 19740-72-8
Synonym(s):
Diisopropyl bicarbamate;Diisopropyl hydrazine-1,2-dicarboxylate
CAS NO.：19740-72-8
Empirical Formula: C8H16N2O4
Molecular Weight: 204.22
MDL number: MFCD19443326
EINECS: 243-263-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB127.20 | In Stock |
|
| 250MG | RMB147.20 | In Stock |
|
| 1G | RMB409.60 | In Stock |
|
| 5g | RMB1563.20 | In Stock |
|
| 25g | RMB5113.60 | In Stock |
|
| 100g | RMB17454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270℃ |
| Boiling point: | 271.5±9.0 °C(Predicted) |
| Density | 1.098±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.97±0.43(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H16N2O4/c1-5(2)13-7(11)9-10-8(12)14-6(3)4/h5-6H,1-4H3,(H,9,11)(H,10,12) |
| InChIKey | FBZULTVJWVCJQV-UHFFFAOYSA-N |
| SMILES | N(C(OC(C)C)=O)NC(OC(C)C)=O |
| EPA Substance Registry System | 1,2-Hydrazinedicarboxylic acid, bis(1-methylethyl) ester (19740-72-8) |
Description and Uses
Orlistat USP Related Compound B
Safety
| Symbol(GHS) |   GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H228.2-H301 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313 |
| RIDADR | UN2930 |
| WGK Germany | 3 |
| HazardClass | 6.1, 4.1 |
| HS Code | 2924190002 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
