A3856312
5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride , 98% , 312753-53-0
CAS NO.：312753-53-0
Empirical Formula: C13H20ClN
Molecular Weight: 225.76
MDL number: MFCD13185940
EINECS: 691-331-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB181.60 | In Stock |
|
| 100mg | RMB280.80 | In Stock |
|
| 250MG | RMB475.20 | In Stock |
|
| 1G | RMB939.20 | In Stock |
|
| 5g | RMB2850.40 | In Stock |
|
| 10g | RMB4830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250 ºC |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C13H19N.ClH/c1-3-9-5-11-7-13(14)8-12(11)6-10(9)4-2;/h5-6,13H,3-4,7-8,14H2,1-2H3;1H |
| InChIKey | ZOVIYWYFBOQKIA-UHFFFAOYSA-N |
| SMILES | C1C2C=C(CC)C(CC)=CC=2CC1N.Cl |
| CAS DataBase Reference | 312753-53-0(CAS DataBase Reference) |
Description and Uses
5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H312-H315-H302-H332 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501 |
