A3868012
Diethyl 2,5-dihydroxyterephthalate , 95% , 5870-38-2
Synonym(s):
2,5-Dihydroxyterephthalic acid diethyl ester
CAS NO.:5870-38-2
Empirical Formula: C12H14O6
Molecular Weight: 254.24
MDL number: MFCD00055430
EINECS: 227-522-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB118.40 | In Stock |
|
| 5G | RMB367.20 | In Stock |
|
| 25g | RMB1288.00 | In Stock |
|
| 100g | RMB4239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-137 °C(lit.) |
| Boiling point: | 408.5±40.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.59±0.23(Predicted) |
| Appearance | Light yellow to green yellow Solid |
| InChI | InChI=1S/C12H14O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | UQOUOXLHXPHDHF-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)=CC(O)=C(C(OCC)=O)C=C1O |
| EPA Substance Registry System | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diethyl ester (5870-38-2) |
Description and Uses
Diethyl 2,5-dihydroxyterephthalate is used as an intermediate for the synthesis of MOF material ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






