A3932112
Ethyl 2-oxocyclopentanecarboxylate , 97% , 611-10-9
Synonym(s):
2-(Ethoxycarbonyl)cyclopentanone;Ethyl cyclopentanone-2-carboxylate
CAS NO.：611-10-9
Empirical Formula: C8H12O3
Molecular Weight: 156.18
MDL number: MFCD00001412
EINECS: 210-253-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB41.60 | In Stock |
|
| 100G | RMB119.20 | In Stock |
|
| 500G | RMB396.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-104 °C/11 mmHg (lit.) |
| Density | 1.054 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 172 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 12.02±0.20(Predicted) |
| color | Clear colorless to pale yellow |
| Water Solubility | insoluble |
| BRN | 387787 |
| InChI | InChI=1S/C8H12O3/c1-2-11-8(10)6-4-3-5-7(6)9/h6H,2-5H2,1H3 |
| InChIKey | JHZPNBKZPAWCJD-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CCCC1=O |
| LogP | 0.330 (est) |
| CAS DataBase Reference | 611-10-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentanecarboxylic acid, 2-oxo-, ethyl ester(611-10-9) |
Description and Uses
Pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36/37-26 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
