A3932312
Ethyl isobutyrylacetate , 98% , 7152-15-0
Synonym(s):
Ethyl 4-methyl-3-oxopentanoate
CAS NO.：7152-15-0
Empirical Formula: C8H14O3
Molecular Weight: 158.2
MDL number: MFCD00009198
EINECS: 230-491-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB197.60 | In Stock |
|
| 100G | RMB640.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -9 °C (lit.) |
| Boiling point: | 173 °C (lit.) |
| Density | 0.98 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 128 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform and methanol. |
| form | Liquid |
| pka | 10.61±0.46(Predicted) |
| color | Clear colorless to light yellow |
| BRN | 636726 |
| InChI | InChI=1S/C8H14O3/c1-4-11-8(10)5-7(9)6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | XCLDSQRVMMXWMS-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(=O)C(C)C |
| CAS DataBase Reference | 7152-15-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentanoic acid, 4-methyl-3-oxo-, ethyl ester(7152-15-0) |
Description and Uses
Ethyl Isobutyrylacetate is used in the synthesis of piperazine derivatives as possible multireceptor atypical antipsychotics, affecting dopamine and serotonin receptor properties . Also used in the synthesis of pyrazinecarboxamide DGAT1 (diacylglycerol acyltransferase 1) inhibitors used in the treatment of obesity.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P241-P280a-P501a-P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29183000 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
