A3938312
Ethyl bromofluoroacetate , 97% , 401-55-8
CAS NO.:401-55-8
Empirical Formula: C4H6BrFO2
Molecular Weight: 184.99
MDL number: MFCD00042095
EINECS: 206-928-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB334.40 | In Stock |
|
| 100G | RMB1231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 154 °C (lit.) |
| Density | 1.565 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 159 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| Specific Gravity | 1.5407 |
| color | Clear yellow |
| Water Solubility | It is soluble in water. |
| InChI | InChI=1S/C4H6BrFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 |
| InChIKey | ULNDTPIRBQGESN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)F |
| CAS DataBase Reference | 401-55-8(CAS DataBase Reference) |
Description and Uses
Ethyl bromofluoroacetate is an intermediate useful for the synthesis of polyfluoroalkyl-substituted fluoro enol ethers1 and N-protected α-fluoroglycines.2
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS07,GHS06,GHS08,GHS05 |
| Signal word | Warning |
| Hazard statements | H227-H301+H311+H331-H341-H301-H311-H318-H331-H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P210e-P301+P310a-P501a-P261-P280-P305+P351+P338-P201-P202-P210-P264-P270-P271-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P308+P313-P403+P233-P405-P501 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| TSCA | T |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







