A3938612
2-Ethylhexyl 4-(dimethylamino)benzoate , 98% , 21245-02-3
Synonym(s):
EHDAB;Octyl dimethyl PABA;2-Ethylhexyl 4-(dimethylamino)benzoate;4-(Dimethylamino)benzoic acid 2-ethylhexyl ester;2-Ethylhexyl N ,N -dimethyl-p -aminobenzoate
CAS NO.:21245-02-3
Empirical Formula: C17H27NO2
Molecular Weight: 277.4
MDL number: MFCD00017526
EINECS: 244-289-3
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB29.60 | In Stock |
|
| 100ML | RMB80.00 | In Stock |
|
| 500ML | RMB288.80 | In Stock |
|
| 2.5L | RMB1287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242.5-243.5 °C |
| Boiling point: | 325 °C (lit.) |
| Density | 0.995 g/mL at 25 °C (lit.) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| pka | 2.39±0.12(Predicted) |
| color | Off-White to Orange |
| Specific Gravity | 0.995 |
| Water Solubility | 100μg/L at 20℃ |
| Merck | 14,3232 |
| Cosmetics Ingredients Functions | UV ABSORBER UV FILTER LIGHT STABILIZER |
| InChI | 1S/C17H27NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4/h9-12,14H,5-8,13H2,1-4H3 |
| InChIKey | WYWZRNAHINYAEF-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccc(cc1)N(C)C |
| LogP | 6.2 |
| CAS DataBase Reference | 21245-02-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Padimate o(21245-02-3) |
| EPA Substance Registry System | 2-Ethylhexyl p-dimethylaminobenzoate (21245-02-3) |
Description and Uses
2-ethylhexyl-4-dimethyl-amino-benzoate is used as an UV-B-absorbing agent in sunscreens and cosmetic creams, lotions, lipsticks, sun oils, moisturizers, nail polish, etc.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
| Hazardous Substances Data | 21245-02-3(Hazardous Substances Data) |





