A3939112
Ethylene glycol methyl ether methacrylate , 98%, containing 60-100ppmmehq stabilizer , 6976-93-8
Synonym(s):
2-Methoxyethyl methacrylate
CAS NO.：6976-93-8
Empirical Formula: C7H12O3
Molecular Weight: 144.17
MDL number: MFCD00048122
EINECS: 230-241-9
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB79.20 | In Stock |
|
| 100ML | RMB239.20 | In Stock |
|
| 500ML | RMB506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65 °C12 mm Hg(lit.) |
| Density | 0.993 g/mL at 25 °C(lit.) |
| vapor pressure | 22.3Pa at 20℃ |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 31.33g/L at 20℃ |
| InChI | InChI=1S/C7H12O3/c1-6(2)7(8)10-5-4-9-3/h1,4-5H2,2-3H3 |
| InChIKey | YXYJVFYWCLAXHO-UHFFFAOYSA-N |
| SMILES | C(OCCOC)(=O)C(C)=C |
| LogP | 1.3 at 23.3℃ |
| CAS DataBase Reference | 6976-93-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Methoxyethyl methacrylate (6976-93-8) |
Description and Uses
Used in the synthesis of copolymers of styrene and 2-methoxyethyl methacrylate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29161400 |
