A3939412
Ethyl 2-oxo-4-phenylbutyrate , 92% , 64920-29-2
CAS NO.：64920-29-2
Empirical Formula: C12H14O3
Molecular Weight: 206.24
MDL number: MFCD00037533
EINECS: 265-276-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB362.40 | In Stock |
|
| 100G | RMB1146.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 132 °C/2 mmHg (lit.) |
| Density | 1.091 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless |
| BRN | 2725083 |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | STPXIOGYOLJXMZ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)CC(=O)C(=O)OCC |
| CAS DataBase Reference | 64920-29-2(CAS DataBase Reference) |
Description and Uses
Ethyl 2-oxo-4-phenylbutyrate may be used in the synthesis of ethyl (R)-2-hydroxy-4-phenylbutyrate, an important chiral precursor for angiotensin-converting enzyme (ACE) inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36/37-26 |
| WGK Germany | 3 |
