A3939512
Ethyl 3-benzoylacrylate , 90% , 17450-56-5
CAS NO.:17450-56-5
Empirical Formula: C12H12O3
Molecular Weight: 204.22
MDL number: MFCD00011533
EINECS: 621-286-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 10G | RMB63.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 50G | RMB292.80 | In Stock |
|
| 100G | RMB361.60 | In Stock |
|
| 250G | RMB901.60 | In Stock |
|
| 500g | RMB1547.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32 °C |
| Boiling point: | 184-185 °C/25 mmHg (lit.) |
| Density | 1.112 g/mL at 25 °C (lit.) |
| refractive index | 1.542-1.546 |
| Flash point: | 88°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Specific Gravity | 1.112 |
| BRN | 2210035 |
| InChI | 1S/C12H12O3/c1-2-15-12(14)9-8-11(13)10-6-4-3-5-7-10/h3-9H,2H2,1H3/b9-8+ |
| InChIKey | ACXLBHHUHSJENU-HJWRWDBZSA-N |
| SMILES | CCOC(=O)\C=C\C(=O)c1ccccc1 |
| CAS DataBase Reference | 17450-56-5(CAS DataBase Reference) |
Description and Uses
Ethyl 3-benzoylacrylate is an impurity of Enalapril (E555250), an?antihypertensive and an angiotensin-converting enzyme (ACE) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 24/25-37/39-26-36 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29183000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





