A3946512
4'-Ethoxyacetophenone , 98% , 1676-63-7
Synonym(s):
1-(4-Ethoxyphenyl)ethan-1-one;1-(4-Ethoxyphenyl)ethanone
CAS NO.:1676-63-7
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00009095
EINECS: 216-825-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB255.20 | In Stock |
|
| 100G | RMB889.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C (lit.) |
| Boiling point: | 268-269 °C/758 mmHg (lit.) |
| Density | 1.0326 (rough estimate) |
| refractive index | 1.5180 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in alcohol, water(791.1 mg/L). |
| BRN | 636783 |
| InChI | InChI=1S/C10H12O2/c1-3-12-10-6-4-9(5-7-10)8(2)11/h4-7H,3H2,1-2H3 |
| InChIKey | YJFNFQHMQJCPRG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OCC)C=C1)C |
| CAS DataBase Reference | 1676-63-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(4-ethoxyphenyl)-(1676-63-7) |
| EPA Substance Registry System | 4'-Ethoxy acetophenone (1676-63-7) |
Description and Uses
4'-Ethoxyacetophenone is used to produce 4-(4-ethoxy-phenyl)-thiazol-2-ylamine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-26-22 |
| Safety Statements | 26-37/39-45-36/37-28 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |




